C18H32N4O3 — CID 111660777
3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide (PubChem CID 111660777) has the molecular formula C18H32N4O3 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide.
| Compound Name | 3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 111660777 |
| Molecular Formula | C18H32N4O3 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | 3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCN/C(=N/CC(C)(O)c1cc(C)oc1C)NCC |
| InChI | InChI=1S/C18H32N4O3/c1-6-9-20-16(23)8-10-21-17(19-7-2)22-12-18(5,24)15-11-13(3)25-14(15)4/h11,24H,6-10,12H2,1-5H3,(H,20,23)(H2,19,21,22) |
| InChIKey | VNZKEULJLXOXLY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|