C18H32IN3O4 — CID 111660466
propan-2-yl 3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111660466) has the molecular formula C18H32IN3O4 and a molecular weight of 481.38 g/mol. Its IUPAC name is propan-2-yl 3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | propan-2-yl 3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111660466 |
| Molecular Formula | C18H32IN3O4 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | propan-2-yl 3-[[N'-[2-(2,5-dimethylfuran-3-yl)-2-hydroxypropyl]-N-ethylcarbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cc(C)oc1C)NCCC(=O)OC(C)C.I |
| InChI | InChI=1S/C18H31N3O4.HI/c1-7-19-17(20-9-8-16(22)24-12(2)3)21-11-18(6,23)15-10-13(4)25-14(15)5;/h10,12,23H,7-9,11H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | XDERISALXRSJKO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|