C17H32IN3O3 — CID 111355367
2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-(4-methoxybutyl)guanidine;hydroiodide (PubChem CID 111355367) has the molecular formula C17H32IN3O3 and a molecular weight of 453.37 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-(4-methoxybutyl)guanidine;hydroiodide.
| Compound Name | 2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-(4-methoxybutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111355367 |
| Molecular Formula | C17H32IN3O3 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-(3-ethoxypropyl)-1-[2-(furan-2-yl)ethyl]-3-(4-methoxybutyl)guanidine;hydroiodide |
| SMILES | CCOCCC/N=C(\NCCCCOC)NCCc1ccco1.I |
| InChI | InChI=1S/C17H31N3O3.HI/c1-3-22-14-7-11-19-17(18-10-4-5-13-21-2)20-12-9-16-8-6-15-23-16;/h6,8,15H,3-5,7,9-14H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | UUVOHSHSPIHUOE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|