C17H26IN3O2S — CID 111494527
1-[2-(furan-2-yl)ethyl]-2-(3-methoxypropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111494527) has the molecular formula C17H26IN3O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-(3-methoxypropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-(3-methoxypropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111494527 |
| Molecular Formula | C17H26IN3O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-(3-methoxypropyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | COCCC/N=C(\NCCc1ccco1)NCCc1cccs1.I |
| InChI | InChI=1S/C17H25N3O2S.HI/c1-21-12-4-9-18-17(19-10-7-15-5-2-13-22-15)20-11-8-16-6-3-14-23-16;/h2-3,5-6,13-14H,4,7-12H2,1H3,(H2,18,19,20);1H |
| InChIKey | NFRJITYFEJIGQJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|