C22H26IN3O3S — CID 111860552
methyl 4-[[[[2-(furan-2-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 111860552) has the molecular formula C22H26IN3O3S and a molecular weight of 539.44 g/mol. Its IUPAC name is methyl 4-[[[[2-(furan-2-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | methyl 4-[[[[2-(furan-2-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111860552 |
| Molecular Formula | C22H26IN3O3S |
| Molecular Weight | 539.44 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | methyl 4-[[[[2-(furan-2-yl)ethylamino]-(2-thiophen-2-ylethylamino)methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | COC(=O)c1ccc(C/N=C(\NCCc2ccco2)NCCc2cccs2)cc1.I |
| InChI | InChI=1S/C22H25N3O3S.HI/c1-27-21(26)18-8-6-17(7-9-18)16-25-22(23-12-10-19-4-2-14-28-19)24-13-11-20-5-3-15-29-20;/h2-9,14-15H,10-13,16H2,1H3,(H2,23,24,25);1H |
| InChIKey | ATOTUHLNUMKUSL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|