C22H28IN3O3S — CID 110051301
1-[2-(furan-2-yl)ethyl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110051301) has the molecular formula C22H28IN3O3S and a molecular weight of 541.46 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110051301 |
| Molecular Formula | C22H28IN3O3S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[2-[(4-methoxyphenyl)methoxy]ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(COCCN/C(=N/Cc2cccs2)NCCc2ccco2)cc1.I |
| InChI | InChI=1S/C22H27N3O3S.HI/c1-26-19-8-6-18(7-9-19)17-27-14-12-24-22(25-16-21-5-3-15-29-21)23-11-10-20-4-2-13-28-20;/h2-9,13,15H,10-12,14,16-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | YPIAVXYGXHBUPV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|