C22H28IN3O3S — CID 111378279
1-[1-(2,5-dimethoxyphenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111378279) has the molecular formula C22H28IN3O3S and a molecular weight of 541.46 g/mol. Its IUPAC name is 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111378279 |
| Molecular Formula | C22H28IN3O3S |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 1-[1-(2,5-dimethoxyphenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(OC)c(C(C)N/C(=N/Cc2cccs2)NCCc2ccco2)c1.I |
| InChI | InChI=1S/C22H27N3O3S.HI/c1-16(20-14-18(26-2)8-9-21(20)27-3)25-22(24-15-19-7-5-13-29-19)23-11-10-17-6-4-12-28-17;/h4-9,12-14,16H,10-11,15H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | QLJSGNPXHGHRLQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|