C18H23NO3S — CID 9477807
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide (PubChem CID 9477807) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 9477807 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-thiophen-2-ylbutanamide |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)CCCc2cccs2)c1 |
| InChI | InChI=1S/C18H23NO3S/c1-13(16-12-14(21-2)9-10-17(16)22-3)19-18(20)8-4-6-15-7-5-11-23-15/h5,7,9-13H,4,6,8H2,1-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | OJTRXXGVCDAIMI-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |