C17H27NO5 — CID 94463951
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(2-methoxyethoxy)butanamide (PubChem CID 94463951) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(2-methoxyethoxy)butanamide.
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(2-methoxyethoxy)butanamide |
|---|---|
| PubChem CID | 94463951 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-4-(2-methoxyethoxy)butanamide |
| SMILES | COCCOCCCC(=O)N[C@@H](C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H27NO5/c1-13(15-12-14(21-3)7-8-16(15)22-4)18-17(19)6-5-9-23-11-10-20-2/h7-8,12-13H,5-6,9-11H2,1-4H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | FHHWGRSONLMKGP-ZDUSSCGKSA-N |
| XLogP | 2.32 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|