C20H25NO3 — CID 100562771
N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-ethylphenyl)acetamide (PubChem CID 100562771) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-ethylphenyl)acetamide.
| Compound Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 100562771 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(CC(=O)N[C@@H](C)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-5-15-6-8-16(9-7-15)12-20(22)21-14(2)18-13-17(23-3)10-11-19(18)24-4/h6-11,13-14H,5,12H2,1-4H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | QVKZJLVKOGWZAP-AWEZNQCLSA-N |
| XLogP | 3.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |