C19H20F3NO3 — CID 51272702
N-[1-(2,5-dimethoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 51272702) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51272702 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F3NO3/c1-12(16-11-15(25-2)8-9-17(16)26-3)23-18(24)10-13-4-6-14(7-5-13)19(20,21)22/h4-9,11-12H,10H2,1-3H3,(H,23,24) |
| InChIKey | MDDMNNAHBBQWBM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |