C18H19ClFNO3 — CID 133230731
2-(4-chloro-2-fluorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide (PubChem CID 133230731) has the molecular formula C18H19ClFNO3 and a molecular weight of 351.81 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 133230731 |
| Molecular Formula | C18H19ClFNO3 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)Cc2ccc(Cl)cc2F)c1 |
| InChI | InChI=1S/C18H19ClFNO3/c1-11(15-10-14(23-2)6-7-17(15)24-3)21-18(22)8-12-4-5-13(19)9-16(12)20/h4-7,9-11H,8H2,1-3H3,(H,21,22) |
| InChIKey | MLSJPALIQBOXTR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |