C18H20ClNO4 — CID 39854287
5-chloro-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-methoxybenzamide (PubChem CID 39854287) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is 5-chloro-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 39854287 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-chloro-N-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-2-methoxybenzamide |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)c2cc(Cl)ccc2OC)c1 |
| InChI | InChI=1S/C18H20ClNO4/c1-11(14-10-13(22-2)6-8-16(14)23-3)20-18(21)15-9-12(19)5-7-17(15)24-4/h5-11H,1-4H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | VSPOFIWTYIVMIM-NSHDSACASA-N |
| XLogP | 3.86 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |