C18H20FNO3 — CID 9477708
N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)acetamide (PubChem CID 9477708) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)acetamide.
| Compound Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 9477708 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-2-(2-fluorophenyl)acetamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)Cc2ccccc2F)c1 |
| InChI | InChI=1S/C18H20FNO3/c1-12(15-11-14(22-2)8-9-17(15)23-3)20-18(21)10-13-6-4-5-7-16(13)19/h4-9,11-12H,10H2,1-3H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | CBOXMGROTUAYSM-GFCCVEGCSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |