C18H22N2O3 — CID 119691812
2-anilino-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide (PubChem CID 119691812) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-anilino-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-anilino-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 119691812 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-anilino-N-[1-(2,5-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)CNc2ccccc2)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-13(16-11-15(22-2)9-10-17(16)23-3)20-18(21)12-19-14-7-5-4-6-8-14/h4-11,13,19H,12H2,1-3H3,(H,20,21) |
| InChIKey | DFFPEZRXXZDRIZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |