C17H16F3NO3 — CID 24535021
N-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 24535021) has the molecular formula C17H16F3NO3 and a molecular weight of 339.31 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24535021 |
| Molecular Formula | C17H16F3NO3 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)Cc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H16F3NO3/c1-23-13-7-8-15(24-2)14(10-13)21-16(22)9-11-3-5-12(6-4-11)17(18,19)20/h3-8,10H,9H2,1-2H3,(H,21,22) |
| InChIKey | RNAOONSJGFBIPO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |