C16H17NO4 — CID 61399992
N-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)acetamide (PubChem CID 61399992) has the molecular formula C16H17NO4 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 61399992 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(3-hydroxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)Cc2cccc(O)c2)c1 |
| InChI | InChI=1S/C16H17NO4/c1-20-13-6-7-15(21-2)14(10-13)17-16(19)9-11-4-3-5-12(18)8-11/h3-8,10,18H,9H2,1-2H3,(H,17,19) |
| InChIKey | ZYQVOLCSKSCNAG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |