C16H15ClFNO3 — CID 839117
2-(2-chloro-6-fluorophenyl)-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 839117) has the molecular formula C16H15ClFNO3 and a molecular weight of 323.75 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 839117 |
| Molecular Formula | C16H15ClFNO3 |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C16H15ClFNO3/c1-21-10-6-7-15(22-2)14(8-10)19-16(20)9-11-12(17)4-3-5-13(11)18/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | QDIVMMKYCSXVSY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |