C16H15ClFNO — CID 839109
2-(2-chloro-6-fluorophenyl)-N-(2-ethylphenyl)acetamide (PubChem CID 839109) has the molecular formula C16H15ClFNO and a molecular weight of 291.75 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 839109 |
| Molecular Formula | C16H15ClFNO |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H15ClFNO/c1-2-11-6-3-4-9-15(11)19-16(20)10-12-13(17)7-5-8-14(12)18/h3-9H,2,10H2,1H3,(H,19,20) |
| InChIKey | GPVUAWMRIOOPMN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |