C14H10Cl2FNO — CID 9413330
2-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)acetamide (PubChem CID 9413330) has the molecular formula C14H10Cl2FNO and a molecular weight of 298.14 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 9413330 |
| Molecular Formula | C14H10Cl2FNO |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2FNO/c15-9-4-6-10(7-5-9)18-14(19)8-11-12(16)2-1-3-13(11)17/h1-7H,8H2,(H,18,19) |
| InChIKey | XDRFBDARQYTEAT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |