C14H10Cl3FN2O — CID 24535666
N-(4-amino-3,5-dichlorophenyl)-2-(2-chloro-6-fluorophenyl)acetamide (PubChem CID 24535666) has the molecular formula C14H10Cl3FN2O and a molecular weight of 347.60 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-(2-chloro-6-fluorophenyl)acetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-(2-chloro-6-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 24535666 |
| Molecular Formula | C14H10Cl3FN2O |
| Molecular Weight | 347.60 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-(2-chloro-6-fluorophenyl)acetamide |
| SMILES | Nc1c(Cl)cc(NC(=O)Cc2c(F)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl3FN2O/c15-9-2-1-3-12(18)8(9)6-13(21)20-7-4-10(16)14(19)11(17)5-7/h1-5H,6,19H2,(H,20,21) |
| InChIKey | XHRHJWWKOYXZEP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|