C14H9Cl2F2NO2 — CID 82880113
N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,6-difluorophenyl)acetamide (PubChem CID 82880113) has the molecular formula C14H9Cl2F2NO2 and a molecular weight of 332.13 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,6-difluorophenyl)acetamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 82880113 |
| Molecular Formula | C14H9Cl2F2NO2 |
| Molecular Weight | 332.13 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,6-difluorophenyl)acetamide |
| SMILES | O=C(Cc1c(F)cccc1F)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2F2NO2/c15-9-4-7(5-10(16)14(9)21)19-13(20)6-8-11(17)2-1-3-12(8)18/h1-5,21H,6H2,(H,19,20) |
| InChIKey | ZEHVCVCPUFNSAZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.13 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|