C15H12BrClFNO — CID 107583887
N-(3-bromo-5-methylphenyl)-2-(2-chloro-6-fluorophenyl)acetamide (PubChem CID 107583887) has the molecular formula C15H12BrClFNO and a molecular weight of 356.62 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-2-(2-chloro-6-fluorophenyl)acetamide.
| Compound Name | N-(3-bromo-5-methylphenyl)-2-(2-chloro-6-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 107583887 |
| Molecular Formula | C15H12BrClFNO |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-2-(2-chloro-6-fluorophenyl)acetamide |
| SMILES | Cc1cc(Br)cc(NC(=O)Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C15H12BrClFNO/c1-9-5-10(16)7-11(6-9)19-15(20)8-12-13(17)3-2-4-14(12)18/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | PONBROLCSUPIEF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |