C15H10ClF4NO — CID 7962141
2-(2-chloro-6-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 7962141) has the molecular formula C15H10ClF4NO and a molecular weight of 331.70 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7962141 |
| Molecular Formula | C15H10ClF4NO |
| Molecular Weight | 331.70 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10ClF4NO/c16-12-2-1-3-13(17)11(12)8-14(22)21-10-6-4-9(5-7-10)15(18,19)20/h1-7H,8H2,(H,21,22) |
| InChIKey | IQDRRCJUWXQRIK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |