C17H26IN3OS — CID 111002250
1-[2-(furan-2-yl)ethyl]-3-(3-methylbutan-2-yl)-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111002250) has the molecular formula C17H26IN3OS and a molecular weight of 447.39 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-(3-methylbutan-2-yl)-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-(3-methylbutan-2-yl)-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111002250 |
| Molecular Formula | C17H26IN3OS |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-(3-methylbutan-2-yl)-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CC(C)C(C)N/C(=N/Cc1cccs1)NCCc1ccco1.I |
| InChI | InChI=1S/C17H25N3OS.HI/c1-13(2)14(3)20-17(19-12-16-7-5-11-22-16)18-9-8-15-6-4-10-21-15;/h4-7,10-11,13-14H,8-9,12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | AXTBPEWPNHJTEE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|