C20H22FN3OS — CID 111354802
1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111354802) has the molecular formula C20H22FN3OS and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111354802 |
| Molecular Formula | C20H22FN3OS |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | Fc1cccc(CCN/C(=N/Cc2cccs2)NCCc2ccco2)c1 |
| InChI | InChI=1S/C20H22FN3OS/c21-17-5-1-4-16(14-17)8-10-22-20(24-15-19-7-3-13-26-19)23-11-9-18-6-2-12-25-18/h1-7,12-14H,8-11,15H2,(H2,22,23,24) |
| InChIKey | VQTLJPNMUSBJLR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|