C20H26FN3O2 — CID 111651664
1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine (PubChem CID 111651664) has the molecular formula C20H26FN3O2 and a molecular weight of 359.44 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111651664 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine |
| SMILES | Fc1cccc(CCN/C(=N/CC2CCCO2)NCCc2ccco2)c1 |
| InChI | InChI=1S/C20H26FN3O2/c21-17-5-1-4-16(14-17)8-10-22-20(24-15-19-7-3-13-26-19)23-11-9-18-6-2-12-25-18/h1-2,4-6,12,14,19H,3,7-11,13,15H2,(H2,22,23,24) |
| InChIKey | KXYDBEIXSXLLAC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|