C20H23FIN3O2S — CID 110052703
2-[(3-fluoro-5-methoxyphenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110052703) has the molecular formula C20H23FIN3O2S and a molecular weight of 515.39 g/mol. Its IUPAC name is 2-[(3-fluoro-5-methoxyphenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(3-fluoro-5-methoxyphenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110052703 |
| Molecular Formula | C20H23FIN3O2S |
| Molecular Weight | 515.39 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 2-[(3-fluoro-5-methoxyphenyl)methyl]-1-[2-(furan-2-yl)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1cc(F)cc(C/N=C(\NCCc2ccco2)NCc2cccs2)c1.I |
| InChI | InChI=1S/C20H22FN3O2S.HI/c1-25-18-11-15(10-16(21)12-18)13-23-20(24-14-19-5-3-9-27-19)22-7-6-17-4-2-8-26-17;/h2-5,8-12H,6-7,13-14H2,1H3,(H2,22,23,24);1H |
| InChIKey | WVTBCWLCAZITFZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|