C22H24FIN4OS — CID 111354493
1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111354493) has the molecular formula C22H24FIN4OS and a molecular weight of 538.43 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111354493 |
| Molecular Formula | C22H24FIN4OS |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indol-3-yl)ethyl]-3-[2-(furan-2-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | Fc1ccc2c(CCN/C(=N/Cc3cccs3)NCCc3ccco3)c[nH]c2c1.I |
| InChI | InChI=1S/C22H23FN4OS.HI/c23-17-5-6-20-16(14-26-21(20)13-17)7-9-24-22(27-15-19-4-2-12-29-19)25-10-8-18-3-1-11-28-18;/h1-6,11-14,26H,7-10,15H2,(H2,24,25,27);1H |
| InChIKey | HDXYXWGLGDUJPD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|