C19H25FIN5S — CID 111536054
1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111536054) has the molecular formula C19H25FIN5S and a molecular weight of 501.41 g/mol. Its IUPAC name is 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111536054 |
| Molecular Formula | C19H25FIN5S |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | 1-ethyl-2-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C19H24FN5S.HI/c1-3-15-11-24-18(26-15)12-25-19(21-4-2)22-8-7-13-10-23-17-9-14(20)5-6-16(13)17;/h5-6,9-11,23H,3-4,7-8,12H2,1-2H3,(H2,21,22,25);1H |
| InChIKey | VSESOPWWWBKBTE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|