C20H27N5S — CID 111509753
1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine (PubChem CID 111509753) has the molecular formula C20H27N5S and a molecular weight of 369.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111509753 |
| Molecular Formula | C20H27N5S |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-ethyl-2-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-3-[2-(1H-indol-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1ncc(CC)s1)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H27N5S/c1-3-16-14-25-19(26-16)10-12-23-20(21-4-2)22-11-9-15-13-24-18-8-6-5-7-17(15)18/h5-8,13-14,24H,3-4,9-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | KJJAZVFPJSLWJT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|