C21H28IN5 — CID 109400928
1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide (PubChem CID 109400928) has the molecular formula C21H28IN5 and a molecular weight of 477.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109400928 |
| Molecular Formula | C21H28IN5 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(3-methyl-4-pyridinyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1ccncc1C)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C21H27N5.HI/c1-3-23-21(24-12-9-17-8-11-22-14-16(17)2)25-13-10-18-15-26-20-7-5-4-6-19(18)20;/h4-8,11,14-15,26H,3,9-10,12-13H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | DCEIAXBGQXNSDR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|