C18H22F3IN6 — CID 111888828
2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111888828) has the molecular formula C18H22F3IN6 and a molecular weight of 506.31 g/mol. Its IUPAC name is 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888828 |
| Molecular Formula | C18H22F3IN6 |
| Molecular Weight | 506.31 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C18H21F3N6.HI/c1-2-22-18(26-11-16-23-7-8-27(16)17(20)21)24-6-5-12-10-25-15-9-13(19)3-4-14(12)15;/h3-4,7-10,17,25H,2,5-6,11H2,1H3,(H2,22,24,26);1H |
| InChIKey | ZIUKAHVOUQMNSJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|