C21H29FIN7 — CID 111888232
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111888232) has the molecular formula C21H29FIN7 and a molecular weight of 525.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888232 |
| Molecular Formula | C21H29FIN7 |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCCC2)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C21H28FN7.HI/c1-2-23-21(26-14-20-28-27-19-6-4-3-5-11-29(19)20)24-10-9-15-13-25-18-12-16(22)7-8-17(15)18;/h7-8,12-13,25H,2-6,9-11,14H2,1H3,(H2,23,24,26);1H |
| InChIKey | DLZYXEIUAZYGQO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|