C22H32IN7 — CID 110997240
1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 110997240) has the molecular formula C22H32IN7 and a molecular weight of 521.45 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110997240 |
| Molecular Formula | C22H32IN7 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 1-ethyl-3-[2-(1H-indol-3-yl)ethyl]-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1nnc2n1CCCCC2)NCCc1c[nH]c2ccccc12.I |
| InChI | InChI=1S/C22H31N7.HI/c1-2-23-22(24-13-11-17-16-26-19-9-6-5-8-18(17)19)25-14-12-21-28-27-20-10-4-3-7-15-29(20)21;/h5-6,8-9,16,26H,2-4,7,10-15H2,1H3,(H2,23,24,25);1H |
| InChIKey | NEJVXGLKOWQNBL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|