C24H38N6 — CID 111891959
1-[2-(4-tert-butylphenyl)ethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine (PubChem CID 111891959) has the molecular formula C24H38N6 and a molecular weight of 410.61 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)ethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine.
| Compound Name | 1-[2-(4-tert-butylphenyl)ethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111891959 |
| Molecular Formula | C24H38N6 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)ethyl]-3-ethyl-2-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1nnc2n1CCCCC2)NCCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H38N6/c1-5-25-23(26-16-14-19-10-12-20(13-11-19)24(2,3)4)27-17-15-22-29-28-21-9-7-6-8-18-30(21)22/h10-13H,5-9,14-18H2,1-4H3,(H2,25,26,27) |
| InChIKey | LXFPGNSXLDUSGQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|