C17H23ClN6 — CID 111020237
1-[2-(4-chlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine (PubChem CID 111020237) has the molecular formula C17H23ClN6 and a molecular weight of 346.87 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111020237 |
| Molecular Formula | C17H23ClN6 |
| Molecular Weight | 346.87 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN6/c1-2-19-17(20-10-9-13-5-7-14(18)8-6-13)21-12-16-23-22-15-4-3-11-24(15)16/h5-8H,2-4,9-12H2,1H3,(H2,19,20,21) |
| InChIKey | PUASFPBAHIBHNM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.87 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|