C20H30N6O2S — CID 111614627
1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 111614627) has the molecular formula C20H30N6O2S and a molecular weight of 418.57 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111614627 |
| Molecular Formula | C20H30N6O2S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 1-ethyl-3-[2-(4-methylsulfonylphenyl)ethyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCCC2)NCCc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H30N6O2S/c1-3-21-20(22-13-12-16-8-10-17(11-9-16)29(2,27)28)23-15-19-25-24-18-7-5-4-6-14-26(18)19/h8-11H,3-7,12-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | SZHIOVAOXNBYOU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|