C20H31IN6 — CID 111245260
1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111245260) has the molecular formula C20H31IN6 and a molecular weight of 482.41 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111245260 |
| Molecular Formula | C20H31IN6 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-ethyl-2-[(4-methylphenyl)methyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NCCc1nnc2n1CCCCC2.I |
| InChI | InChI=1S/C20H30N6.HI/c1-3-21-20(23-15-17-10-8-16(2)9-11-17)22-13-12-19-25-24-18-7-5-4-6-14-26(18)19;/h8-11H,3-7,12-15H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | YIXDJHMSEBBBNC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|