C17H25IN6 — CID 111020292
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-[(4-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111020292) has the molecular formula C17H25IN6 and a molecular weight of 440.33 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-[(4-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-[(4-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111020292 |
| Molecular Formula | C17H25IN6 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-[(4-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)cc1)NCc1nnc2n1CCC2.I |
| InChI | InChI=1S/C17H24N6.HI/c1-3-18-17(19-11-14-8-6-13(2)7-9-14)20-12-16-22-21-15-5-4-10-23(15)16;/h6-9H,3-5,10-12H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | RURIQIWMFHZFDE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|