C14H21IN6O — CID 119117063
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-(furan-3-ylmethyl)guanidine;hydroiodide (PubChem CID 119117063) has the molecular formula C14H21IN6O and a molecular weight of 416.27 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-(furan-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-(furan-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119117063 |
| Molecular Formula | C14H21IN6O |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-ethyl-2-(furan-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccoc1)NCc1nnc2n1CCC2.I |
| InChI | InChI=1S/C14H20N6O.HI/c1-2-15-14(16-8-11-5-7-21-10-11)17-9-13-19-18-12-4-3-6-20(12)13;/h5,7,10H,2-4,6,8-9H2,1H3,(H2,15,16,17);1H |
| InChIKey | YTFHXBOMDLBXDC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|