C15H23IN6S — CID 111258528
1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111258528) has the molecular formula C15H23IN6S and a molecular weight of 446.36 g/mol. Its IUPAC name is 1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258528 |
| Molecular Formula | C15H23IN6S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 1-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)NCc1cccs1.I |
| InChI | InChI=1S/C15H22N6S.HI/c1-2-16-15(17-10-12-6-5-9-22-12)18-11-14-20-19-13-7-3-4-8-21(13)14;/h5-6,9H,2-4,7-8,10-11H2,1H3,(H2,16,17,18);1H |
| InChIKey | OGZJYXHICHQINB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|