C17H26N6S — CID 111259959
1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine (PubChem CID 111259959) has the molecular formula C17H26N6S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111259959 |
| Molecular Formula | C17H26N6S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]-2-(thiophen-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1cccs1)NCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C17H26N6S/c1-2-18-17(20-13-14-7-6-12-24-14)19-10-9-16-22-21-15-8-4-3-5-11-23(15)16/h6-7,12H,2-5,8-11,13H2,1H3,(H2,18,19,20) |
| InChIKey | DJSAEISICDUERV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|