C20H34IN7O — CID 111593547
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111593547) has the molecular formula C20H34IN7O and a molecular weight of 515.44 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111593547 |
| Molecular Formula | C20H34IN7O |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCc1nnc2n1CCCCC2.I |
| InChI | InChI=1S/C20H33N7O.HI/c1-5-21-19(24-14-18-23-13-15(28-18)20(2,3)4)22-11-10-17-26-25-16-9-7-6-8-12-27(16)17;/h13H,5-12,14H2,1-4H3,(H2,21,22,24);1H |
| InChIKey | DCKLIMWUDDDDED-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|