C25H32N6 — CID 111233705
1-(3,3-diphenylpropyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111233705) has the molecular formula C25H32N6 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-(3,3-diphenylpropyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111233705 |
| Molecular Formula | C25H32N6 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N6/c1-2-26-25(28-19-24-30-29-23-15-9-10-18-31(23)24)27-17-16-22(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-8,11-14,22H,2,9-10,15-19H2,1H3,(H2,26,27,28) |
| InChIKey | HCZNFHWFHQVULU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|