C19H36N6 — CID 111204744
1-ethyl-3-(7-methyloctyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111204744) has the molecular formula C19H36N6 and a molecular weight of 348.54 g/mol. Its IUPAC name is 1-ethyl-3-(7-methyloctyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-(7-methyloctyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111204744 |
| Molecular Formula | C19H36N6 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | 1-ethyl-3-(7-methyloctyl)-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)NCCCCCCC(C)C |
| InChI | InChI=1S/C19H36N6/c1-4-20-19(21-13-9-6-5-7-11-16(2)3)22-15-18-24-23-17-12-8-10-14-25(17)18/h16H,4-15H2,1-3H3,(H2,20,21,22) |
| InChIKey | LPXOBPMRDZOXST-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|