C19H34N6O — CID 111576301
1-(2-cycloheptyloxyethyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111576301) has the molecular formula C19H34N6O and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-(2-cycloheptyloxyethyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-(2-cycloheptyloxyethyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111576301 |
| Molecular Formula | C19H34N6O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | 1-(2-cycloheptyloxyethyl)-3-ethyl-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCC2)NCCOC1CCCCCC1 |
| InChI | InChI=1S/C19H34N6O/c1-2-20-19(21-12-14-26-16-9-5-3-4-6-10-16)22-15-18-24-23-17-11-7-8-13-25(17)18/h16H,2-15H2,1H3,(H2,20,21,22) |
| InChIKey | RXDQZMYMYUQDHS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|