C19H34N6O2 — CID 111648072
1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine (PubChem CID 111648072) has the molecular formula C19H34N6O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111648072 |
| Molecular Formula | C19H34N6O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2n1CCCCC2)NCCCOCC1CCOC1 |
| InChI | InChI=1S/C19H34N6O2/c1-2-20-19(21-9-6-11-26-14-16-8-12-27-15-16)22-13-18-24-23-17-7-4-3-5-10-25(17)18/h16H,2-15H2,1H3,(H2,20,21,22) |
| InChIKey | QFNPIDSVKMGABY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|