C21H39IN6O2 — CID 111644115
2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 111644115) has the molecular formula C21H39IN6O2 and a molecular weight of 534.49 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111644115 |
| Molecular Formula | C21H39IN6O2 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 2-methyl-1-[3-(oxan-4-ylmethoxy)propyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCOCC1)NCCCc1nnc2n1CCCCC2.I |
| InChI | InChI=1S/C21H38N6O2.HI/c1-22-21(24-12-6-14-29-17-18-9-15-28-16-10-18)23-11-5-8-20-26-25-19-7-3-2-4-13-27(19)20;/h18H,2-17H2,1H3,(H2,22,23,24);1H |
| InChIKey | REQIDQBCWGIKLJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|