C16H31IN6 — CID 111579568
2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide (PubChem CID 111579568) has the molecular formula C16H31IN6 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide.
| Compound Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111579568 |
| Molecular Formula | C16H31IN6 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-1-ethyl-3-(5-methylhexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2n1CCC2)NCCCCC(C)C.I |
| InChI | InChI=1S/C16H30N6.HI/c1-4-17-16(18-10-6-5-8-13(2)3)19-12-15-21-20-14-9-7-11-22(14)15;/h13H,4-12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | RTJSMVKLKPTYOR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|